C8H14O4 — CID 138983814
(3aR,6S,7aR)-6-methoxy-4-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 138983814) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3aR,6S,7aR)-6-methoxy-4-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,6S,7aR)-6-methoxy-4-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 138983814 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (3aR,6S,7aR)-6-methoxy-4-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CO[C@@H]1C[C@H]2OCO[C@@H]2C(C)O1 |
| InChI | InChI=1S/C8H14O4/c1-5-8-6(10-4-11-8)3-7(9-2)12-5/h5-8H,3-4H2,1-2H3/t5?,6-,7+,8-/m1/s1 |
| InChIKey | UPMBCZBZRRLVJX-KTUCCBJNSA-N |
| XLogP | 0.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |