C22H26N2O4 — CID 121284160
tert-butyl (2S,3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]-2-methylpyrrolidine-1-carboxylate (PubChem CID 121284160) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121284160 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | tert-butyl (2S,3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](Oc2cccc(-c3cccc(C=O)c3)n2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26N2O4/c1-15-19(11-12-24(15)21(26)28-22(2,3)4)27-20-10-6-9-18(23-20)17-8-5-7-16(13-17)14-25/h5-10,13-15,19H,11-12H2,1-4H3/t15-,19-/m0/s1 |
| InChIKey | GWLZJBNTYZCNNH-KXBFYZLASA-N |
| XLogP | 4.34 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|