C39H48O5 — CID 121286376
1,3-bis(4-butoxyphenyl)-5-[4-[3-(2-methoxyethoxymethoxy)propyl]phenyl]benzene (PubChem CID 121286376) has the molecular formula C39H48O5 and a molecular weight of 596.81 g/mol. Its IUPAC name is 1,3-bis(4-butoxyphenyl)-5-[4-[3-(2-methoxyethoxymethoxy)propyl]phenyl]benzene.
| Compound Name | 1,3-bis(4-butoxyphenyl)-5-[4-[3-(2-methoxyethoxymethoxy)propyl]phenyl]benzene |
|---|---|
| PubChem CID | 121286376 |
| Molecular Formula | C39H48O5 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | 1,3-bis(4-butoxyphenyl)-5-[4-[3-(2-methoxyethoxymethoxy)propyl]phenyl]benzene |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccc(CCCOCOCCOC)cc3)cc(-c3ccc(OCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C39H48O5/c1-4-6-23-43-38-18-14-33(15-19-38)36-27-35(28-37(29-36)34-16-20-39(21-17-34)44-24-7-5-2)32-12-10-31(11-13-32)9-8-22-41-30-42-26-25-40-3/h10-21,27-29H,4-9,22-26,30H2,1-3H3 |
| InChIKey | FZTZLUXMOPEGAX-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|