C28H34N4O7 — CID 121288108
(5R,9R,10S,12R)-9-(dimethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide (PubChem CID 121288108) has the molecular formula C28H34N4O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is (5R,9R,10S,12R)-9-(dimethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide.
| Compound Name | (5R,9R,10S,12R)-9-(dimethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide |
|---|---|
| PubChem CID | 121288108 |
| Molecular Formula | C28H34N4O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (5R,9R,10S,12R)-9-(dimethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide |
| SMILES | CN1CC2CCN(C)C2c2cc(O)c3c(c21)C[C@H]1C[C@H]2[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C1=C3O |
| InChI | InChI=1S/C28H34N4O7/c1-30(2)22-15-8-12-7-13-18(16(33)9-14-20-11(5-6-31(20)3)10-32(4)21(13)14)23(34)17(12)25(36)28(15,39)26(37)19(24(22)35)27(29)38/h9,11-12,15,20,22,33-34,37,39H,5-8,10H2,1-4H3,(H2,29,38)/t11?,12-,15-,20?,22+,28-/m0/s1 |
| InChIKey | VGTXITJTQCOYQZ-YVZARSIGSA-N |
| XLogP | 0.41 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|