C30H38N4O7 — CID 73388192
(5R,9S,10S,12R)-9-(diethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide (PubChem CID 73388192) has the molecular formula C30H38N4O7 and a molecular weight of 566.66 g/mol. Its IUPAC name is (5R,9S,10S,12R)-9-(diethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide.
| Compound Name | (5R,9S,10S,12R)-9-(diethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide |
|---|---|
| PubChem CID | 73388192 |
| Molecular Formula | C30H38N4O7 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | (5R,9S,10S,12R)-9-(diethylamino)-2,5,6,25-tetrahydroxy-16,21-dimethyl-4,8-dioxo-16,21-diazahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-1(25),2,6,14,23-pentaene-7-carboxamide |
| SMILES | CCN(CC)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc5c(c4C[C@H]3C[C@@H]12)N(C)CC1CCN(C)C51 |
| InChI | InChI=1S/C30H38N4O7/c1-5-34(6-2)24-17-10-14-9-15-20(18(35)11-16-22-13(7-8-32(22)3)12-33(4)23(15)16)25(36)19(14)27(38)30(17,41)28(39)21(26(24)37)29(31)40/h11,13-14,17,22,24,35-36,39,41H,5-10,12H2,1-4H3,(H2,31,40)/t13?,14-,17-,22?,24-,30-/m0/s1 |
| InChIKey | UKRGYDDGPUIFHP-LSSXEFHOSA-N |
| XLogP | 1.19 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|