C30H40N4O7 — CID 121288097
(8aR,12R,12aR,13aS)-12-(dimethylamino)-4-[ethyl(propyl)amino]-6,7,8a,9-tetrahydroxy-1-methyl-8,11-dioxo-2,3,4,12,12a,13,13a,14-octahydroanthra[3,2-h]quinoline-10-carboxamide (PubChem CID 121288097) has the molecular formula C30H40N4O7 and a molecular weight of 568.67 g/mol. Its IUPAC name is (8aR,12R,12aR,13aS)-12-(dimethylamino)-4-[ethyl(propyl)amino]-6,7,8a,9-tetrahydroxy-1-methyl-8,11-dioxo-2,3,4,12,12a,13,13a,14-octahydroanthra[3,2-h]quinoline-10-carboxamide.
| Compound Name | (8aR,12R,12aR,13aS)-12-(dimethylamino)-4-[ethyl(propyl)amino]-6,7,8a,9-tetrahydroxy-1-methyl-8,11-dioxo-2,3,4,12,12a,13,13a,14-octahydroanthra[3,2-h]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 121288097 |
| Molecular Formula | C30H40N4O7 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | (8aR,12R,12aR,13aS)-12-(dimethylamino)-4-[ethyl(propyl)amino]-6,7,8a,9-tetrahydroxy-1-methyl-8,11-dioxo-2,3,4,12,12a,13,13a,14-octahydroanthra[3,2-h]quinoline-10-carboxamide |
| SMILES | CCCN(CC)C1CCN(C)c2c1cc(O)c1c2C[C@@H]2C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C2=C1O |
| InChI | InChI=1S/C30H40N4O7/c1-6-9-34(7-2)18-8-10-33(5)23-15(18)13-19(35)21-16(23)11-14-12-17-24(32(3)4)26(37)22(29(31)40)28(39)30(17,41)27(38)20(14)25(21)36/h13-14,17-18,24,35-36,39,41H,6-12H2,1-5H3,(H2,31,40)/t14-,17-,18?,24-,30+/m1/s1 |
| InChIKey | SIYCAESONCWJCD-KHYNJETJSA-N |
| XLogP | 1.58 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|