C22H29ClN10 — CID 121289483
7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-(1,4-diazabicyclo[3.2.1]octan-4-yl)phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 121289483) has the molecular formula C22H29ClN10 and a molecular weight of 469.00 g/mol. Its IUPAC name is 7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-(1,4-diazabicyclo[3.2.1]octan-4-yl)phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-(1,4-diazabicyclo[3.2.1]octan-4-yl)phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 121289483 |
| Molecular Formula | C22H29ClN10 |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-(1,4-diazabicyclo[3.2.1]octan-4-yl)phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | NCc1cc(Nc2nc(NC3CC3)c3ncc(CN)n3n2)c(Cl)c(N2CCN3CCC2C3)c1 |
| InChI | InChI=1S/C22H29ClN10/c23-19-17(7-13(9-24)8-18(19)32-6-5-31-4-3-15(32)12-31)28-22-29-20(27-14-1-2-14)21-26-11-16(10-25)33(21)30-22/h7-8,11,14-15H,1-6,9-10,12,24-25H2,(H2,27,28,29,30) |
| InChIKey | NBZGHYDRTJACRP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|