C22H29ClN10 — CID 121289481
7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 121289481) has the molecular formula C22H29ClN10 and a molecular weight of 469.00 g/mol. Its IUPAC name is 7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 121289481 |
| Molecular Formula | C22H29ClN10 |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 7-(aminomethyl)-2-N-[5-(aminomethyl)-2-chloro-3-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-N-cyclopropylimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CN1C[C@H]2C[C@@H]1CN2c1cc(CN)cc(Nc2nc(NC3CC3)c3ncc(CN)n3n2)c1Cl |
| InChI | InChI=1S/C22H29ClN10/c1-31-10-15-6-14(31)11-32(15)18-5-12(7-24)4-17(19(18)23)28-22-29-20(27-13-2-3-13)21-26-9-16(8-25)33(21)30-22/h4-5,9,13-15H,2-3,6-8,10-11,24-25H2,1H3,(H2,27,28,29,30)/t14-,15-/m1/s1 |
| InChIKey | KJLPNMBBIRGGTO-HUUCEWRRSA-N |
| XLogP | 1.91 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|