C20H20ClF2N9O — CID 123408504
2-N-[2-chloro-5-(difluoromethoxy)-3-piperazin-1-ylphenyl]-4-N-cyclopropyl-7-isocyanoimidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 123408504) has the molecular formula C20H20ClF2N9O and a molecular weight of 475.89 g/mol. Its IUPAC name is 2-N-[2-chloro-5-(difluoromethoxy)-3-piperazin-1-ylphenyl]-4-N-cyclopropyl-7-isocyanoimidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-[2-chloro-5-(difluoromethoxy)-3-piperazin-1-ylphenyl]-4-N-cyclopropyl-7-isocyanoimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 123408504 |
| Molecular Formula | C20H20ClF2N9O |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-N-[2-chloro-5-(difluoromethoxy)-3-piperazin-1-ylphenyl]-4-N-cyclopropyl-7-isocyanoimidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(OC(F)F)cc(N4CCNCC4)c3Cl)nn12 |
| InChI | InChI=1S/C20H20ClF2N9O/c1-24-15-10-26-18-17(27-11-2-3-11)29-20(30-32(15)18)28-13-8-12(33-19(22)23)9-14(16(13)21)31-6-4-25-5-7-31/h8-11,19,25H,2-7H2,(H2,27,28,29,30) |
| InChIKey | PMRBZIZDOOPJLQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|