C30H34N4O3S — CID 121290785
N-[(2E,4E)-5-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide (PubChem CID 121290785) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[(2E,4E)-5-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide.
| Compound Name | N-[(2E,4E)-5-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 121290785 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[(2E,4E)-5-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide |
| SMILES | C=C/C(=C\C=C(/C)NS(=O)(=O)c1cccc2cccnc12)C(=O)N1CCN(Cc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C30H34N4O3S/c1-5-25(30(35)34-18-16-33(17-19-34)21-27-20-22(2)11-12-23(27)3)14-13-24(4)32-38(36,37)28-10-6-8-26-9-7-15-31-29(26)28/h5-15,20,32H,1,16-19,21H2,2-4H3/b24-13+,25-14+ |
| InChIKey | VSHRQUDWMZJVFM-GUJRAXHGSA-N |
| XLogP | 4.49 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|