C29H30FN3O4S — CID 146582408
N-[(2E,4E)-5-[4-(4-fluoro-2-methylphenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide (PubChem CID 146582408) has the molecular formula C29H30FN3O4S and a molecular weight of 535.64 g/mol. Its IUPAC name is N-[(2E,4E)-5-[4-(4-fluoro-2-methylphenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide.
| Compound Name | N-[(2E,4E)-5-[4-(4-fluoro-2-methylphenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 146582408 |
| Molecular Formula | C29H30FN3O4S |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N-[(2E,4E)-5-[4-(4-fluoro-2-methylphenyl)-4-hydroxypiperidine-1-carbonyl]hepta-2,4,6-trien-2-yl]quinoline-8-sulfonamide |
| SMILES | C=C/C(=C\C=C(/C)NS(=O)(=O)c1cccc2cccnc12)C(=O)N1CCC(O)(c2ccc(F)cc2C)CC1 |
| InChI | InChI=1S/C29H30FN3O4S/c1-4-22(28(34)33-17-14-29(35,15-18-33)25-13-12-24(30)19-20(25)2)11-10-21(3)32-38(36,37)26-9-5-7-23-8-6-16-31-27(23)26/h4-13,16,19,32,35H,1,14-15,17-18H2,2-3H3/b21-10+,22-11+ |
| InChIKey | AQFWKGDJXBFOFC-OIEABDAFSA-N |
| XLogP | 4.49 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|