About 4-ethoxyaniline;2-oxoindole-5-sulfonic acid
4-ethoxyaniline;2-oxoindole-5-sulfonic acid (PubChem CID 121292563) has the molecular formula C16H16N2O5S
and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-ethoxyaniline;2-oxoindole-5-sulfonic acid.
Molecular Properties
| Compound Name | 4-ethoxyaniline;2-oxoindole-5-sulfonic acid |
| PubChem CID | 121292563 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-ethoxyaniline;2-oxoindole-5-sulfonic acid |
| SMILES | CCOc1ccc(N)cc1.O=C1C=c2cc(S(=O)(=O)O)ccc2=N1 |
| InChI | InChI=1S/C8H5NO4S.C8H11NO/c10-8-4-5-3-6(14(11,12)13)1-2-7(5)9-8;1-2-10-8-5-3-7(9)4-6-8/h1-4H,(H,11,12,13);3-6H,2,9H2,1H3 |
| InChIKey | VWBVVUQZMJYYSY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxyaniline;2-oxoindole-5-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxyaniline;2-oxoindole-5-sulfonic acid?
The IUPAC name of 4-ethoxyaniline;2-oxoindole-5-sulfonic acid (CID 121292563) is 4-ethoxyaniline;2-oxoindole-5-sulfonic acid.
What is the SMILES notation for 4-ethoxyaniline;2-oxoindole-5-sulfonic acid?
The canonical SMILES for 4-ethoxyaniline;2-oxoindole-5-sulfonic acid is CCOc1ccc(N)cc1.O=C1C=c2cc(S(=O)(=O)O)ccc2=N1.
What is the InChIKey of 4-ethoxyaniline;2-oxoindole-5-sulfonic acid?
The InChIKey is VWBVVUQZMJYYSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO4S.C8H11NO/c10-8-4-5-3-6(14(11,12)13)1-2-7(5)9-8;1-2-10-8-5-3-7(9)4-6-8/h1-4H,(H,11,12,13);3-6H,2,9H2,1H3.
What are the key properties of 4-ethoxyaniline;2-oxoindole-5-sulfonic acid?
4-ethoxyaniline;2-oxoindole-5-sulfonic acid has a molecular weight of 348.38 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyaniline;2-oxoindole-5-sulfonic acid is sourced from PubChem (CID 121292563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).