About 5-ethoxyindol-2-one
5-ethoxyindol-2-one (PubChem CID 23212399) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 5-ethoxyindol-2-one.
Molecular Properties
| Compound Name | 5-ethoxyindol-2-one |
| PubChem CID | 23212399 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5-ethoxyindol-2-one |
| SMILES | CCOc1ccc2c(c1)=CC(=O)N=2 |
| InChI | InChI=1S/C10H9NO2/c1-2-13-8-3-4-9-7(5-8)6-10(12)11-9/h3-6H,2H2,1H3 |
| InChIKey | KZPFJATVUHMANN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethoxyindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxyindol-2-one?
The IUPAC name of 5-ethoxyindol-2-one (CID 23212399) is 5-ethoxyindol-2-one.
What is the SMILES notation for 5-ethoxyindol-2-one?
The canonical SMILES for 5-ethoxyindol-2-one is CCOc1ccc2c(c1)=CC(=O)N=2.
What is the InChIKey of 5-ethoxyindol-2-one?
The InChIKey is KZPFJATVUHMANN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-2-13-8-3-4-9-7(5-8)6-10(12)11-9/h3-6H,2H2,1H3.
What are the key properties of 5-ethoxyindol-2-one?
5-ethoxyindol-2-one has a molecular weight of 175.19 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxyindol-2-one is sourced from PubChem (CID 23212399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).