C30H20Br2N2O2 — CID 121295185
9,10-bis(6-bromo-2-pyridinyl)-2-phenylanthracene-9,10-diol (PubChem CID 121295185) has the molecular formula C30H20Br2N2O2 and a molecular weight of 600.31 g/mol. Its IUPAC name is 9,10-bis(6-bromo-2-pyridinyl)-2-phenylanthracene-9,10-diol.
| Compound Name | 9,10-bis(6-bromo-2-pyridinyl)-2-phenylanthracene-9,10-diol |
|---|---|
| PubChem CID | 121295185 |
| Molecular Formula | C30H20Br2N2O2 |
| Molecular Weight | 600.31 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | 9,10-bis(6-bromo-2-pyridinyl)-2-phenylanthracene-9,10-diol |
| SMILES | OC1(c2cccc(Br)n2)c2ccccc2C(O)(c2cccc(Br)n2)c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C30H20Br2N2O2/c31-27-14-6-12-25(33-27)29(35)21-10-4-5-11-22(21)30(36,26-13-7-15-28(32)34-26)24-18-20(16-17-23(24)29)19-8-2-1-3-9-19/h1-18,35-36H |
| InChIKey | YSEDOACGOCZKAW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.31 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|