C11H18ClN — CID 121302538
2,2-dimethylpropyl(phenyl)azanium chloride (PubChem CID 121302538) has the molecular formula C11H18ClN and a molecular weight of 199.73 g/mol. Its IUPAC name is 2,2-dimethylpropyl(phenyl)azanium chloride.
| Compound Name | 2,2-dimethylpropyl(phenyl)azanium chloride |
|---|---|
| PubChem CID | 121302538 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.73 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2,2-dimethylpropyl(phenyl)azanium chloride |
| SMILES | CC(C)(C)C[NH2+]c1ccccc1.[Cl-] |
| InChI | InChI=1S/C11H17N.ClH/c1-11(2,3)9-12-10-7-5-4-6-8-10;/h4-8,12H,9H2,1-3H3;1H |
| InChIKey | DYYXOOFYBWQONE-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.73 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|