C33H69N3 — CID 121302597
1,1,3,3-tetrakis(2,4,4-trimethylpentan-2-yl)guanidine (PubChem CID 121302597) has the molecular formula C33H69N3 and a molecular weight of 507.94 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(2,4,4-trimethylpentan-2-yl)guanidine.
| Compound Name | 1,1,3,3-tetrakis(2,4,4-trimethylpentan-2-yl)guanidine |
|---|---|
| PubChem CID | 121302597 |
| Molecular Formula | C33H69N3 |
| Molecular Weight | 507.94 g/mol |
| Exact Mass | 507.55 |
| IUPAC Name | 1,1,3,3-tetrakis(2,4,4-trimethylpentan-2-yl)guanidine |
| SMILES | [H]N=C(N(C(C)(C)CC(C)(C)C)C(C)(C)CC(C)(C)C)N(C(C)(C)CC(C)(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C33H69N3/c1-26(2,3)21-30(13,14)35(31(15,16)22-27(4,5)6)25(34)36(32(17,18)23-28(7,8)9)33(19,20)24-29(10,11)12/h34H,21-24H2,1-20H3 |
| InChIKey | ZFOGBBQQVBKAAQ-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.94 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|