C20H39NO — CID 87205211
2-methyl-N,N-bis(2,4,4-trimethylpentan-2-yl)prop-2-enamide (PubChem CID 87205211) has the molecular formula C20H39NO and a molecular weight of 309.54 g/mol. Its IUPAC name is 2-methyl-N,N-bis(2,4,4-trimethylpentan-2-yl)prop-2-enamide.
| Compound Name | 2-methyl-N,N-bis(2,4,4-trimethylpentan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 87205211 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 2-methyl-N,N-bis(2,4,4-trimethylpentan-2-yl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C(C)(C)CC(C)(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H39NO/c1-15(2)16(22)21(19(9,10)13-17(3,4)5)20(11,12)14-18(6,7)8/h1,13-14H2,2-12H3 |
| InChIKey | NSAXMSMHXQVFPR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|