C20H9F30NO — CID 139789964
2-methyl-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)prop-2-enamide (PubChem CID 139789964) has the molecular formula C20H9F30NO and a molecular weight of 849.24 g/mol. Its IUPAC name is 2-methyl-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)prop-2-enamide.
| Compound Name | 2-methyl-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)prop-2-enamide |
|---|---|
| PubChem CID | 139789964 |
| Molecular Formula | C20H9F30NO |
| Molecular Weight | 849.24 g/mol |
| Exact Mass | 849.02 |
| IUPAC Name | 2-methyl-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C20H9F30NO/c1-5(2)6(52)51(19(47,48)17(43,44)15(39,40)13(35,36)11(31,32)7(21,22)3-9(25,26)27)20(49,50)18(45,46)16(41,42)14(37,38)12(33,34)8(23,24)4-10(28,29)30/h1,3-4H2,2H3 |
| InChIKey | RKKGURHWQHLJSL-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.24 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|