C8H15NO5 — CID 153499824
N,N-bis(1,1-dihydroxyethyl)-2-methylprop-2-enamide (PubChem CID 153499824) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is N,N-bis(1,1-dihydroxyethyl)-2-methylprop-2-enamide.
| Compound Name | N,N-bis(1,1-dihydroxyethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 153499824 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N,N-bis(1,1-dihydroxyethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C(C)(O)O)C(C)(O)O |
| InChI | InChI=1S/C8H15NO5/c1-5(2)6(10)9(7(3,11)12)8(4,13)14/h11-14H,1H2,2-4H3 |
| InChIKey | SUWCROXRDAYSTP-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|