C25H24Cl2F6N4O3S — CID 121303266
N-(2-cyano-2-methylpropyl)-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-[(2S)-2-methylpiperidine-1-carbonyl]-1,3-thiazole-2-carboxamide (PubChem CID 121303266) has the molecular formula C25H24Cl2F6N4O3S and a molecular weight of 645.45 g/mol. Its IUPAC name is N-(2-cyano-2-methylpropyl)-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-[(2S)-2-methylpiperidine-1-carbonyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-(2-cyano-2-methylpropyl)-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-[(2S)-2-methylpiperidine-1-carbonyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 121303266 |
| Molecular Formula | C25H24Cl2F6N4O3S |
| Molecular Weight | 645.45 g/mol |
| Exact Mass | 644.09 |
| IUPAC Name | N-(2-cyano-2-methylpropyl)-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-[(2S)-2-methylpiperidine-1-carbonyl]-1,3-thiazole-2-carboxamide |
| SMILES | C[C@H]1CCCCN1C(=O)c1nc(C(=O)NCC(C)(C)C#N)sc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C25H24Cl2F6N4O3S/c1-12-6-4-5-9-37(12)21(39)17-18(41-20(36-17)19(38)35-11-22(2,3)10-34)13-7-8-14(16(27)15(13)26)23(40,24(28,29)30)25(31,32)33/h7-8,12,40H,4-6,9,11H2,1-3H3,(H,35,38)/t12-/m0/s1 |
| InChIKey | XERAZETYXTXVJQ-LBPRGKRZSA-N |
| XLogP | 6.72 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.45 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |