C19H15Cl2F6N3O5S — CID 121303265
2-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 121303265) has the molecular formula C19H15Cl2F6N3O5S and a molecular weight of 582.31 g/mol. Its IUPAC name is 2-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 121303265 |
| Molecular Formula | C19H15Cl2F6N3O5S |
| Molecular Weight | 582.31 g/mol |
| Exact Mass | 581.00 |
| IUPAC Name | 2-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(CNC(=O)c1nc(C(=O)O)c(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)c(Cl)c2Cl)s1)C(N)=O |
| InChI | InChI=1S/C19H15Cl2F6N3O5S/c1-16(2,15(28)34)5-29-12(31)13-30-10(14(32)33)11(36-13)6-3-4-7(9(21)8(6)20)17(35,18(22,23)24)19(25,26)27/h3-4,35H,5H2,1-2H3,(H2,28,34)(H,29,31)(H,32,33) |
| InChIKey | SPRAOICLKPGIMK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |