C25H26Cl2F7N3O3S — CID 121307642
5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-4-(4-fluoropiperidine-1-carbonyl)-N-(3-hydroxy-3-methylbutyl)-1,3-thiazole-2-carboxamide (PubChem CID 121307642) has the molecular formula C25H26Cl2F7N3O3S and a molecular weight of 652.46 g/mol. Its IUPAC name is 5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-4-(4-fluoropiperidine-1-carbonyl)-N-(3-hydroxy-3-methylbutyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-4-(4-fluoropiperidine-1-carbonyl)-N-(3-hydroxy-3-methylbutyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 121307642 |
| Molecular Formula | C25H26Cl2F7N3O3S |
| Molecular Weight | 652.46 g/mol |
| Exact Mass | 651.10 |
| IUPAC Name | 5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-4-(4-fluoropiperidine-1-carbonyl)-N-(3-hydroxy-3-methylbutyl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)(O)CCNC(=O)c1nc(C(=O)N2CCC(F)CC2)c(-c2ccc(C(C)(C(F)(F)F)C(F)(F)F)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C25H26Cl2F7N3O3S/c1-22(2,40)8-9-35-19(38)20-36-17(21(39)37-10-6-12(28)7-11-37)18(41-20)13-4-5-14(16(27)15(13)26)23(3,24(29,30)31)25(32,33)34/h4-5,12,40H,6-11H2,1-3H3,(H,35,38) |
| InChIKey | NKXFQLQAEALTIN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |