C20H17Cl2F7N2O2S — CID 151086613
[5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-ethyl-1,3-thiazol-4-yl]-(4-fluoropiperidin-1-yl)methanone (PubChem CID 151086613) has the molecular formula C20H17Cl2F7N2O2S and a molecular weight of 553.33 g/mol. Its IUPAC name is [5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-ethyl-1,3-thiazol-4-yl]-(4-fluoropiperidin-1-yl)methanone.
| Compound Name | [5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-ethyl-1,3-thiazol-4-yl]-(4-fluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 151086613 |
| Molecular Formula | C20H17Cl2F7N2O2S |
| Molecular Weight | 553.33 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | [5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-ethyl-1,3-thiazol-4-yl]-(4-fluoropiperidin-1-yl)methanone |
| SMILES | CCc1nc(C(=O)N2CCC(F)CC2)c(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C20H17Cl2F7N2O2S/c1-2-12-30-15(17(32)31-7-5-9(23)6-8-31)16(34-12)10-3-4-11(14(22)13(10)21)18(33,19(24,25)26)20(27,28)29/h3-4,9,33H,2,5-8H2,1H3 |
| InChIKey | MLFWHVRPHHOPHV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.33 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |