C10H15N3O — CID 121317551
3-imidazol-1-yl-6,6-dimethyl-2,5-dihydropyran-5-amine (PubChem CID 121317551) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-imidazol-1-yl-6,6-dimethyl-2,5-dihydropyran-5-amine.
| Compound Name | 3-imidazol-1-yl-6,6-dimethyl-2,5-dihydropyran-5-amine |
|---|---|
| PubChem CID | 121317551 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-imidazol-1-yl-6,6-dimethyl-2,5-dihydropyran-5-amine |
| SMILES | CC1(C)OCC(n2ccnc2)=CC1N |
| InChI | InChI=1S/C10H15N3O/c1-10(2)9(11)5-8(6-14-10)13-4-3-12-7-13/h3-5,7,9H,6,11H2,1-2H3 |
| InChIKey | LNLRADUJKJVUBL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |