About (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol
(2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol (PubChem CID 121320949) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol.
Molecular Properties
| Compound Name | (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
| PubChem CID | 121320949 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
| SMILES | OC[C@H]1C=C[C@@H](O)C1O |
| InChI | InChI=1S/C6H10O3/c7-3-4-1-2-5(8)6(4)9/h1-2,4-9H,3H2/t4-,5-,6?/m1/s1 |
| InChIKey | MIKATYFDVCPCSB-QYRBDRAASA-N |
| XLogP | -1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol?
The IUPAC name of (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol (CID 121320949) is (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol.
What is the SMILES notation for (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol?
The canonical SMILES for (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol is OC[C@H]1C=C[C@@H](O)C1O.
What is the InChIKey of (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol?
The InChIKey is MIKATYFDVCPCSB-QYRBDRAASA-N. The full InChI is InChI=1S/C6H10O3/c7-3-4-1-2-5(8)6(4)9/h1-2,4-9H,3H2/t4-,5-,6?/m1/s1.
What are the key properties of (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol?
(2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol has a molecular weight of 130.14 g/mol, XLogP of -1.11, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-5-(hydroxymethyl)cyclopent-3-ene-1,2-diol is sourced from PubChem (CID 121320949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).