C18H18FN3O — CID 121322086
5-(2-cyclohex-3-en-1-yl-2-nitrosoethyl)-6-fluoro-5H-imidazo[5,1-a]isoindole (PubChem CID 121322086) has the molecular formula C18H18FN3O and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-(2-cyclohex-3-en-1-yl-2-nitrosoethyl)-6-fluoro-5H-imidazo[5,1-a]isoindole.
| Compound Name | 5-(2-cyclohex-3-en-1-yl-2-nitrosoethyl)-6-fluoro-5H-imidazo[5,1-a]isoindole |
|---|---|
| PubChem CID | 121322086 |
| Molecular Formula | C18H18FN3O |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 5-(2-cyclohex-3-en-1-yl-2-nitrosoethyl)-6-fluoro-5H-imidazo[5,1-a]isoindole |
| SMILES | O=NC(CC1c2c(F)cccc2-c2cncn21)C1CC=CCC1 |
| InChI | InChI=1S/C18H18FN3O/c19-14-8-4-7-13-17-10-20-11-22(17)16(18(13)14)9-15(21-23)12-5-2-1-3-6-12/h1-2,4,7-8,10-12,15-16H,3,5-6,9H2 |
| InChIKey | HOYTXCJGPDEGKT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|