C26H30FN2O4P — CID 134257817
1-[4-(4-dimethoxyphosphorylphenyl)cyclohexyl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol (PubChem CID 134257817) has the molecular formula C26H30FN2O4P and a molecular weight of 484.51 g/mol. Its IUPAC name is 1-[4-(4-dimethoxyphosphorylphenyl)cyclohexyl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol.
| Compound Name | 1-[4-(4-dimethoxyphosphorylphenyl)cyclohexyl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
|---|---|
| PubChem CID | 134257817 |
| Molecular Formula | C26H30FN2O4P |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-[4-(4-dimethoxyphosphorylphenyl)cyclohexyl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
| SMILES | COP(=O)(OC)c1ccc(C2CCC(C(O)CC3c4c(F)cccc4-c4cncn43)CC2)cc1 |
| InChI | InChI=1S/C26H30FN2O4P/c1-32-34(31,33-2)20-12-10-18(11-13-20)17-6-8-19(9-7-17)25(30)14-23-26-21(4-3-5-22(26)27)24-15-28-16-29(23)24/h3-5,10-13,15-17,19,23,25,30H,6-9,14H2,1-2H3 |
| InChIKey | YWADQMPIIWWIOF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|