C32H44N2O7 — CID 121322354
butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-4,4-dimethoxy-3,3-dimethylbutanoate (PubChem CID 121322354) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-4,4-dimethoxy-3,3-dimethylbutanoate.
| Compound Name | butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-4,4-dimethoxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 121322354 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-4,4-dimethoxy-3,3-dimethylbutanoate |
| SMILES | CCCCOC(=O)[C@@H](N(C)C(=O)[C@@H](C)N(C)C(=O)OCC1c2ccccc2-c2ccccc21)C(C)(C)C(OC)OC |
| InChI | InChI=1S/C32H44N2O7/c1-9-10-19-40-29(36)27(32(3,4)30(38-7)39-8)34(6)28(35)21(2)33(5)31(37)41-20-26-24-17-13-11-15-22(24)23-16-12-14-18-25(23)26/h11-18,21,26-27,30H,9-10,19-20H2,1-8H3/t21-,27-/m1/s1 |
| InChIKey | CDMMPEFLOKDZDV-JIPXPUAJSA-N |
| XLogP | 5.07 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|