C31H40N2O5 — CID 121322355
butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-3,3-dimethylpent-4-enoate (PubChem CID 121322355) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-3,3-dimethylpent-4-enoate.
| Compound Name | butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-3,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 121322355 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | butyl (2S)-2-[[(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoyl]-methylamino]-3,3-dimethylpent-4-enoate |
| SMILES | C=CC(C)(C)[C@@H](C(=O)OCCCC)N(C)C(=O)[C@@H](C)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H40N2O5/c1-8-10-19-37-29(35)27(31(4,5)9-2)33(7)28(34)21(3)32(6)30(36)38-20-26-24-17-13-11-15-22(24)23-16-12-14-18-25(23)26/h9,11-18,21,26-27H,2,8,10,19-20H2,1,3-7H3/t21-,27-/m1/s1 |
| InChIKey | AWNGWTVHGLYHGR-JIPXPUAJSA-N |
| XLogP | 5.64 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|