C35H48N2O8 — CID 172505997
[(2R,3R)-4-butoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl] (3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoate (PubChem CID 172505997) has the molecular formula C35H48N2O8 and a molecular weight of 624.77 g/mol. Its IUPAC name is [(2R,3R)-4-butoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl] (3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoate.
| Compound Name | [(2R,3R)-4-butoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl] (3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 172505997 |
| Molecular Formula | C35H48N2O8 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | [(2R,3R)-4-butoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl] (3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoate |
| SMILES | CCCCOC(=O)[C@H](NC(=O)OC(C)(C)C)[C@@H](C)OC(=O)C([C@@H](C)CC)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H48N2O8/c1-9-11-20-42-31(38)29(36-33(40)45-35(5,6)7)23(4)44-32(39)30(22(3)10-2)37(8)34(41)43-21-28-26-18-14-12-16-24(26)25-17-13-15-19-27(25)28/h12-19,22-23,28-30H,9-11,20-21H2,1-8H3,(H,36,40)/t22-,23+,29+,30?/m0/s1 |
| InChIKey | HHSYPPGGLUZUCH-TYZRKYANSA-N |
| XLogP | 6.45 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|