C18H20ClN3 — CID 121325864
5-chloro-2-methanimidoyl-3-(4-phenylpiperidin-1-yl)aniline (PubChem CID 121325864) has the molecular formula C18H20ClN3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 5-chloro-2-methanimidoyl-3-(4-phenylpiperidin-1-yl)aniline.
| Compound Name | 5-chloro-2-methanimidoyl-3-(4-phenylpiperidin-1-yl)aniline |
|---|---|
| PubChem CID | 121325864 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-chloro-2-methanimidoyl-3-(4-phenylpiperidin-1-yl)aniline |
| SMILES | [H]/N=C/c1c(N)cc(Cl)cc1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H20ClN3/c19-15-10-17(21)16(12-20)18(11-15)22-8-6-14(7-9-22)13-4-2-1-3-5-13/h1-5,10-12,14,20H,6-9,21H2/b20-12+ |
| InChIKey | IHGZOGZEWLDISG-UDWIEESQSA-N |
| XLogP | 4.30 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|