C16H21ClN4O — CID 121326527
8-(3-amino-5-chloro-2-methanimidoylphenyl)-2-methyl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 121326527) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 8-(3-amino-5-chloro-2-methanimidoylphenyl)-2-methyl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(3-amino-5-chloro-2-methanimidoylphenyl)-2-methyl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 121326527 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 8-(3-amino-5-chloro-2-methanimidoylphenyl)-2-methyl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | [H]/N=C/c1c(N)cc(Cl)cc1N1CCC2(CC1)CC(=O)N(C)C2 |
| InChI | InChI=1S/C16H21ClN4O/c1-20-10-16(8-15(20)22)2-4-21(5-3-16)14-7-11(17)6-13(19)12(14)9-18/h6-7,9,18H,2-5,8,10,19H2,1H3/b18-9+ |
| InChIKey | CYWOONIZFOWJEZ-GIJQJNRQSA-N |
| XLogP | 2.37 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|