C20H22F3NO3 — CID 121333323
2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanoic acid (PubChem CID 121333323) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanoic acid.
| Compound Name | 2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 121333323 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanoic acid |
| SMILES | CCC(C(=O)O)C1CCC(Oc2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H22F3NO3/c1-2-14(19(25)26)12-7-9-13(10-8-12)27-17-11-18(20(21,22)23)24-16-6-4-3-5-15(16)17/h3-6,11-14H,2,7-10H2,1H3,(H,25,26) |
| InChIKey | BSAGHRFTDMEDQN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |