C25H25F3N2O2 — CID 166670928
N-(4-methylphenyl)-2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]acetamide (PubChem CID 166670928) has the molecular formula C25H25F3N2O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 166670928 |
| Molecular Formula | C25H25F3N2O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-[2-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CC2CCC(Oc3cc(C(F)(F)F)nc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C25H25F3N2O2/c1-16-6-10-18(11-7-16)29-24(31)14-17-8-12-19(13-9-17)32-22-15-23(25(26,27)28)30-21-5-3-2-4-20(21)22/h2-7,10-11,15,17,19H,8-9,12-14H2,1H3,(H,29,31) |
| InChIKey | LOALHTXGVXIDFV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |