C27H29F3N2O2 — CID 166670791
N-(4-methylphenyl)-2-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanamide (PubChem CID 166670791) has the molecular formula C27H29F3N2O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanamide.
| Compound Name | N-(4-methylphenyl)-2-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanamide |
|---|---|
| PubChem CID | 166670791 |
| Molecular Formula | C27H29F3N2O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]butanamide |
| SMILES | CCC(C(=O)Nc1ccc(C)cc1)C1CCC(Oc2ccnc3ccc(C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C27H29F3N2O2/c1-3-22(26(33)32-20-9-4-17(2)5-10-20)18-6-11-21(12-7-18)34-25-14-15-31-24-13-8-19(16-23(24)25)27(28,29)30/h4-5,8-10,13-16,18,21-22H,3,6-7,11-12H2,1-2H3,(H,32,33) |
| InChIKey | FYDTXQVPXZHZLM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |