C25H24ClF3N2O2 — CID 126703080
4-chloro-N-[1-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]ethyl]benzamide (PubChem CID 126703080) has the molecular formula C25H24ClF3N2O2 and a molecular weight of 476.93 g/mol. Its IUPAC name is 4-chloro-N-[1-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[1-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]ethyl]benzamide |
|---|---|
| PubChem CID | 126703080 |
| Molecular Formula | C25H24ClF3N2O2 |
| Molecular Weight | 476.93 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-chloro-N-[1-[4-[6-(trifluoromethyl)quinolin-4-yl]oxycyclohexyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)cc1)C1CCC(Oc2ccnc3ccc(C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C25H24ClF3N2O2/c1-15(31-24(32)17-2-7-19(26)8-3-17)16-4-9-20(10-5-16)33-23-12-13-30-22-11-6-18(14-21(22)23)25(27,28)29/h2-3,6-8,11-16,20H,4-5,9-10H2,1H3,(H,31,32) |
| InChIKey | OOSYRRMTSJPIOL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.93 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |