C25H28ClN3O2 — CID 138559378
1-(4-chlorophenyl)-3-[(1R)-1-(4-quinolin-4-yloxycyclohexyl)propyl]urea (PubChem CID 138559378) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1R)-1-(4-quinolin-4-yloxycyclohexyl)propyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1R)-1-(4-quinolin-4-yloxycyclohexyl)propyl]urea |
|---|---|
| PubChem CID | 138559378 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1R)-1-(4-quinolin-4-yloxycyclohexyl)propyl]urea |
| SMILES | CC[C@@H](NC(=O)Nc1ccc(Cl)cc1)C1CCC(Oc2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C25H28ClN3O2/c1-2-22(29-25(30)28-19-11-9-18(26)10-12-19)17-7-13-20(14-8-17)31-24-15-16-27-23-6-4-3-5-21(23)24/h3-6,9-12,15-17,20,22H,2,7-8,13-14H2,1H3,(H2,28,29,30)/t17?,20?,22-/m1/s1 |
| InChIKey | RTRYEKUSQLDYLO-INXVGGANSA-N |
| XLogP | 6.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |