C21H22Cl2N2O2 — CID 175793077
2-[4-[(3-chloro-2-methyl-4-pyridinyl)oxy]cyclohexyl]-N-(4-chlorophenyl)prop-2-enamide (PubChem CID 175793077) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-methyl-4-pyridinyl)oxy]cyclohexyl]-N-(4-chlorophenyl)prop-2-enamide.
| Compound Name | 2-[4-[(3-chloro-2-methyl-4-pyridinyl)oxy]cyclohexyl]-N-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175793077 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[4-[(3-chloro-2-methyl-4-pyridinyl)oxy]cyclohexyl]-N-(4-chlorophenyl)prop-2-enamide |
| SMILES | C=C(C(=O)Nc1ccc(Cl)cc1)C1CCC(Oc2ccnc(C)c2Cl)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c1-13(21(26)25-17-7-5-16(22)6-8-17)15-3-9-18(10-4-15)27-19-11-12-24-14(2)20(19)23/h5-8,11-12,15,18H,1,3-4,9-10H2,2H3,(H,25,26) |
| InChIKey | UMSONDCXXGROJI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|