C13H15F3O2S — CID 121336369
(4S)-4-[(1R)-1-hydroxyethyl]-2-[4-(trifluoromethyl)phenyl]thiolan-3-ol (PubChem CID 121336369) has the molecular formula C13H15F3O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-hydroxyethyl]-2-[4-(trifluoromethyl)phenyl]thiolan-3-ol.
| Compound Name | (4S)-4-[(1R)-1-hydroxyethyl]-2-[4-(trifluoromethyl)phenyl]thiolan-3-ol |
|---|---|
| PubChem CID | 121336369 |
| Molecular Formula | C13H15F3O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (4S)-4-[(1R)-1-hydroxyethyl]-2-[4-(trifluoromethyl)phenyl]thiolan-3-ol |
| SMILES | C[C@@H](O)[C@@H]1CSC(c2ccc(C(F)(F)F)cc2)C1O |
| InChI | InChI=1S/C13H15F3O2S/c1-7(17)10-6-19-12(11(10)18)8-2-4-9(5-3-8)13(14,15)16/h2-5,7,10-12,17-18H,6H2,1H3/t7-,10+,11?,12?/m1/s1 |
| InChIKey | PVBKFFZVSRGNOO-JENKOEBGSA-N |
| XLogP | 2.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |