C21H28O6 — CID 121349040
2-(2-benzyl-1-carboxybutan-2-yl)oxycarbonyl-5-methylcyclohexane-1-carboxylic acid (PubChem CID 121349040) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-(2-benzyl-1-carboxybutan-2-yl)oxycarbonyl-5-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(2-benzyl-1-carboxybutan-2-yl)oxycarbonyl-5-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121349040 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-(2-benzyl-1-carboxybutan-2-yl)oxycarbonyl-5-methylcyclohexane-1-carboxylic acid |
| SMILES | CCC(CC(=O)O)(Cc1ccccc1)OC(=O)C1CCC(C)CC1C(=O)O |
| InChI | InChI=1S/C21H28O6/c1-3-21(13-18(22)23,12-15-7-5-4-6-8-15)27-20(26)16-10-9-14(2)11-17(16)19(24)25/h4-8,14,16-17H,3,9-13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | GUSPCAGRIHDXHN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |