C25H40O2 — CID 121349071
3-benzyl-5-ethyl-3-(4-methylcyclohexyl)nonanoic acid (PubChem CID 121349071) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is 3-benzyl-5-ethyl-3-(4-methylcyclohexyl)nonanoic acid.
| Compound Name | 3-benzyl-5-ethyl-3-(4-methylcyclohexyl)nonanoic acid |
|---|---|
| PubChem CID | 121349071 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | 3-benzyl-5-ethyl-3-(4-methylcyclohexyl)nonanoic acid |
| SMILES | CCCCC(CC)CC(CC(=O)O)(Cc1ccccc1)C1CCC(C)CC1 |
| InChI | InChI=1S/C25H40O2/c1-4-6-10-21(5-2)17-25(19-24(26)27,18-22-11-8-7-9-12-22)23-15-13-20(3)14-16-23/h7-9,11-12,20-21,23H,4-6,10,13-19H2,1-3H3,(H,26,27) |
| InChIKey | XGSGHAAQYIFGCR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |