C19H26N2O3S — CID 88707986
3-(1H-benzimidazol-2-yl)-5-ethyl-3-sulfanylcarbonylnonanoic acid (PubChem CID 88707986) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-5-ethyl-3-sulfanylcarbonylnonanoic acid.
| Compound Name | 3-(1H-benzimidazol-2-yl)-5-ethyl-3-sulfanylcarbonylnonanoic acid |
|---|---|
| PubChem CID | 88707986 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-5-ethyl-3-sulfanylcarbonylnonanoic acid |
| SMILES | CCCCC(CC)CC(CC(=O)O)(C(=O)S)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H26N2O3S/c1-3-5-8-13(4-2)11-19(18(24)25,12-16(22)23)17-20-14-9-6-7-10-15(14)21-17/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | MQRIGBRBTGBEKT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|