C19H26N2O2S2 — CID 88707489
2-(1H-benzimidazol-2-yl)-2,3-ditert-butylbutanebis(thioic S-acid) (PubChem CID 88707489) has the molecular formula C19H26N2O2S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-2,3-ditert-butylbutanebis(thioic S-acid).
| Compound Name | 2-(1H-benzimidazol-2-yl)-2,3-ditert-butylbutanebis(thioic S-acid) |
|---|---|
| PubChem CID | 88707489 |
| Molecular Formula | C19H26N2O2S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-2,3-ditert-butylbutanebis(thioic S-acid) |
| SMILES | CC(C)(C)C(C(=O)S)C(C(=O)S)(c1nc2ccccc2[nH]1)C(C)(C)C |
| InChI | InChI=1S/C19H26N2O2S2/c1-17(2,3)13(14(22)24)19(16(23)25,18(4,5)6)15-20-11-9-7-8-10-12(11)21-15/h7-10,13H,1-6H3,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | DWVLOPLPCWJLFB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|