C21H19BrN6O — CID 121350466
(9S)-4-bromo-5-(2-methyl-4-pyridinyl)-N-pyridin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121350466) has the molecular formula C21H19BrN6O and a molecular weight of 451.33 g/mol. Its IUPAC name is (9S)-4-bromo-5-(2-methyl-4-pyridinyl)-N-pyridin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-bromo-5-(2-methyl-4-pyridinyl)-N-pyridin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350466 |
| Molecular Formula | C21H19BrN6O |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (9S)-4-bromo-5-(2-methyl-4-pyridinyl)-N-pyridin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | Cc1cc(-c2nc3c(cc2Br)N2CC[C@@H](C2)N3C(=O)Nc2cccnc2)ccn1 |
| InChI | InChI=1S/C21H19BrN6O/c1-13-9-14(4-7-24-13)19-17(22)10-18-20(26-19)28(16-5-8-27(18)12-16)21(29)25-15-3-2-6-23-11-15/h2-4,6-7,9-11,16H,5,8,12H2,1H3,(H,25,29)/t16-/m0/s1 |
| InChIKey | VUSBFYHEDKSMCD-INIZCTEOSA-N |
| XLogP | 4.24 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |