C20H21N7O3 — CID 121351642
methyl (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate (PubChem CID 121351642) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate.
| Compound Name | methyl (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate |
|---|---|
| PubChem CID | 121351642 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl (9S)-8-[(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)carbamoyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)N(C(=O)Nc1n[nH]c3nc(C)ccc13)[C@H]1CCCN2C1 |
| InChI | InChI=1S/C20H21N7O3/c1-11-5-6-13-16(21-11)24-25-17(13)23-20(29)27-12-4-3-9-26(10-12)15-8-7-14(19(28)30-2)22-18(15)27/h5-8,12H,3-4,9-10H2,1-2H3,(H2,21,23,24,25,29)/t12-/m0/s1 |
| InChIKey | XPSJTFPADGMEHC-LBPRGKRZSA-N |
| XLogP | 2.47 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |