C25H25F3N6O4 — CID 121351815
(9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide (PubChem CID 121351815) has the molecular formula C25H25F3N6O4 and a molecular weight of 530.51 g/mol. Its IUPAC name is (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide.
| Compound Name | (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide |
|---|---|
| PubChem CID | 121351815 |
| Molecular Formula | C25H25F3N6O4 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (9S)-N-[5-[(2S)-2,3-dihydroxypropoxy]-3-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxamide |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)nc2c1N1C[C@H](CC1C(=O)Nc1cncc(OC[C@@H](O)CO)c1)N2 |
| InChI | InChI=1S/C25H25F3N6O4/c1-13-21-23(33-22(30-13)14-3-2-4-15(5-14)25(26,27)28)31-17-7-20(34(21)10-17)24(37)32-16-6-19(9-29-8-16)38-12-18(36)11-35/h2-6,8-9,17-18,20,35-36H,7,10-12H2,1H3,(H,32,37)(H,30,31,33)/t17-,18-,20?/m0/s1 |
| InChIKey | PCYOXMTZIBKOSK-IJXZTRCJSA-N |
| XLogP | 2.61 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |