C17H16FN5O3 — CID 121352584
7-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylic acid (PubChem CID 121352584) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is 7-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylic acid.
| Compound Name | 7-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylic acid |
|---|---|
| PubChem CID | 121352584 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 7-[(5-fluoro-4-methyl-2-pyridinyl)carbamoyl]-2,7,9-triazatricyclo[6.4.0.03,5]dodeca-1(8),9,11-triene-10-carboxylic acid |
| SMILES | Cc1cc(NC(=O)N2CC3CC3Nc3ccc(C(=O)O)nc32)ncc1F |
| InChI | InChI=1S/C17H16FN5O3/c1-8-4-14(19-6-10(8)18)22-17(26)23-7-9-5-13(9)20-11-2-3-12(16(24)25)21-15(11)23/h2-4,6,9,13,20H,5,7H2,1H3,(H,24,25)(H,19,22,26) |
| InChIKey | DBCPSSRMHRDLHA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |