C23H29F2IN6 — CID 121353226
9-[4-(tert-butylamino)butyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine (PubChem CID 121353226) has the molecular formula C23H29F2IN6 and a molecular weight of 554.43 g/mol. Its IUPAC name is 9-[4-(tert-butylamino)butyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine.
| Compound Name | 9-[4-(tert-butylamino)butyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 121353226 |
| Molecular Formula | C23H29F2IN6 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 9-[4-(tert-butylamino)butyl]-2-fluoro-8-[(3-fluoro-6-iodo-2,3-dihydro-1H-inden-5-yl)methyl]purin-6-amine |
| SMILES | CC(C)(C)NCCCCn1c(Cc2cc3c(cc2I)CCC3F)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C23H29F2IN6/c1-23(2,3)28-8-4-5-9-32-18(29-19-20(27)30-22(25)31-21(19)32)12-14-10-15-13(11-17(14)26)6-7-16(15)24/h10-11,16,28H,4-9,12H2,1-3H3,(H2,27,30,31) |
| InChIKey | BHBCFMNOJJWLDM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|