C20H22FIN6O4 — CID 90072711
N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]-2-hydroxy-2-methylpropanamide (PubChem CID 90072711) has the molecular formula C20H22FIN6O4 and a molecular weight of 556.34 g/mol. Its IUPAC name is N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 90072711 |
| Molecular Formula | C20H22FIN6O4 |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]-2-hydroxy-2-methylpropanamide |
| SMILES | CC(C)(O)C(=O)NCCCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C20H22FIN6O4/c1-20(2,30)18(29)24-4-3-5-28-14(25-15-16(23)26-19(21)27-17(15)28)7-10-6-12-13(8-11(10)22)32-9-31-12/h6,8,30H,3-5,7,9H2,1-2H3,(H,24,29)(H2,23,26,27) |
| InChIKey | MGKZNSLRLXUUJI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|