C19H22FIN6O6S — CID 25262863
4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethoxy]butyl sulfamate (PubChem CID 25262863) has the molecular formula C19H22FIN6O6S and a molecular weight of 608.39 g/mol. Its IUPAC name is 4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethoxy]butyl sulfamate.
| Compound Name | 4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethoxy]butyl sulfamate |
|---|---|
| PubChem CID | 25262863 |
| Molecular Formula | C19H22FIN6O6S |
| Molecular Weight | 608.39 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | 4-[2-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]ethoxy]butyl sulfamate |
| SMILES | Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CCOCCCCOS(N)(=O)=O |
| InChI | InChI=1S/C19H22FIN6O6S/c20-19-25-17(22)16-18(26-19)27(3-6-30-4-1-2-5-33-34(23,28)29)15(24-16)8-11-7-13-14(9-12(11)21)32-10-31-13/h7,9H,1-6,8,10H2,(H2,22,25,26)(H2,23,28,29) |
| InChIKey | VWPCWFWIGWYINI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 166.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|